English Name: | 2,3-Cyclopenteno pyridine | |
CAS NO: | 533-37-9 | |
Molecular weight: | 117.1479 | |
EC NO: | 208-564-1 | |
Molecular Formula: | C8H7N | |
InChI: | InChI=1/C8H7N/c1-3-7-4-2-6-9-8(7)5-1/h1-6,9H | |
Alias: | cyclopentenopyridine | |
Structural Formula: |
Add: Within the territory of the former Denglin Farm Sanfanchang, Liushui Town, Yicheng City, Hubei Province
Contact: Manager Yang
Tel: +86-13797666691
Tel: +86-710-4280293
Copyright(C)2021,Hubei Zhihua Pharmaceutical Chemistry Co., Ltd. Supported by ChemNet ChinaChemNet Toocle 31fabu Copyright Notice