English Name: | Gadoteric acid | |
CAS NO: | 72573-82-1 | |
Molecular weight: | 561.6639 | |
EC NO: | None | |
Molecular Formula: | C16H28GdN4O8 | |
InChI: | InChI=1/C16H28N4O8.Gd/c21-13(22)9-17-1-2-18(10-14(23)24)5-6-20(12-16(27)28)8-7-19(4-3-17)11-15(25)26;/h1-12H2,(H,21,22)(H,23,24)(H,25,26)(H,27,28);/q;+3 | |
Alias: | Gadolinium 2- [4,7,10-tris (carboxymethyl) -1,4,7,10-tetraazacyclododecyl-1-yl] acetate | |
Structural Formula: |
Add: Within the territory of the former Denglin Farm Sanfanchang, Liushui Town, Yicheng City, Hubei Province
Contact: Manager Yang
Tel: +86-13797666691
Tel: +86-710-4280293
Copyright(C)2021,Hubei Zhihua Pharmaceutical Chemistry Co., Ltd. Supported by ChemNet ChinaChemNet Toocle 31fabu Copyright Notice